About CID 171931188
CID 171931188 (PubChem CID 171931188) has the molecular formula C28H33F3N2O
and a molecular weight of 470.58 g/mol.
Molecular Properties
| Compound Name | CID 171931188 |
| PubChem CID | 171931188 |
| Molecular Formula | C28H33F3N2O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | — |
| SMILES | CCc1cc(C(C)=NOCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1C[NH+]1C=C[CH-]1 |
| InChI | InChI=1S/C28H33F3N2O/c1-3-22-17-24(11-12-25(22)18-33-14-7-15-33)20(2)32-34-19-21-10-13-26(23-8-5-4-6-9-23)27(16-21)28(29,30)31/h7,10-17,23,33H,3-6,8-9,18-19H2,1-2H3 |
| InChIKey | BUXOUEBVQJQACP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 171931188 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171931188?
The IUPAC name of CID 171931188 (CID 171931188) is not available.
What is the SMILES notation for CID 171931188?
The canonical SMILES for CID 171931188 is CCc1cc(C(C)=NOCc2ccc(C3CCCCC3)c(C(F)(F)F)c2)ccc1C[NH+]1C=C[CH-]1.
What is the InChIKey of CID 171931188?
The InChIKey is BUXOUEBVQJQACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33F3N2O/c1-3-22-17-24(11-12-25(22)18-33-14-7-15-33)20(2)32-34-19-21-10-13-26(23-8-5-4-6-9-23)27(16-21)28(29,30)31/h7,10-17,23,33H,3-6,8-9,18-19H2,1-2H3.
What are the key properties of CID 171931188?
CID 171931188 has a molecular weight of 470.58 g/mol, XLogP of 6.33, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171931188 is sourced from PubChem (CID 171931188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).