C55H76F3O3PS — CID 171931918
phenyl-bis(2,4,6-tricyclohexylphenyl)phosphane;trifluoromethanesulfonic acid (PubChem CID 171931918) has the molecular formula C55H76F3O3PS and a molecular weight of 905.24 g/mol. Its IUPAC name is phenyl-bis(2,4,6-tricyclohexylphenyl)phosphane;trifluoromethanesulfonic acid.
| Compound Name | phenyl-bis(2,4,6-tricyclohexylphenyl)phosphane;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171931918 |
| Molecular Formula | C55H76F3O3PS |
| Molecular Weight | 905.24 g/mol |
| Exact Mass | 904.52 |
| IUPAC Name | phenyl-bis(2,4,6-tricyclohexylphenyl)phosphane;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.c1ccc(P(c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)cc1 |
| InChI | InChI=1S/C54H75P.CHF3O3S/c1-8-22-40(23-9-1)46-36-49(42-26-12-3-13-27-42)53(50(37-46)43-28-14-4-15-29-43)55(48-34-20-7-21-35-48)54-51(44-30-16-5-17-31-44)38-47(41-24-10-2-11-25-41)39-52(54)45-32-18-6-19-33-45;2-1(3,4)8(5,6)7/h7,20-21,34-45H,1-6,8-19,22-33H2;(H,5,6,7) |
| InChIKey | LCWBVJGKPVDXPK-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.24 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|