C26H27ClF3N3O3 — CID 171931935
1-(3-chlorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]imidazo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171931935) has the molecular formula C26H27ClF3N3O3 and a molecular weight of 521.97 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]imidazo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(3-chlorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]imidazo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171931935 |
| Molecular Formula | C26H27ClF3N3O3 |
| Molecular Weight | 521.97 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]imidazo[1,5-a]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@](C)(C2)[C@H]1NC(=O)c1nc(-c2cccc(Cl)c2)c2ccccn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H26ClN3O.C2HF3O2/c1-23(2)16-10-11-24(3,14-16)22(23)27-21(29)20-26-19(15-7-6-8-17(25)13-15)18-9-4-5-12-28(18)20;3-2(4,5)1(6)7/h4-9,12-13,16,22H,10-11,14H2,1-3H3,(H,27,29);(H,6,7)/t16-,22+,24+;/m1./s1 |
| InChIKey | VZJFGOITSYHKHS-YELVDABOSA-N |
| XLogP | 6.23 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.97 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |