C18H16ClF3N4O3 — CID 171932017
(1R,4S,5S,8S,12R)-3-azido-7-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one (PubChem CID 171932017) has the molecular formula C18H16ClF3N4O3 and a molecular weight of 428.80 g/mol. Its IUPAC name is (1R,4S,5S,8S,12R)-3-azido-7-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one.
| Compound Name | (1R,4S,5S,8S,12R)-3-azido-7-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
|---|---|
| PubChem CID | 171932017 |
| Molecular Formula | C18H16ClF3N4O3 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (1R,4S,5S,8S,12R)-3-azido-7-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
| SMILES | C[C@]12O[C@@]3(CCO[C@H]4[C@@H]3[C@@H]1C(=O)N4c1ccc(Cl)c(C(F)(F)F)c1)CC2N=[N+]=[N-] |
| InChI | InChI=1S/C18H16ClF3N4O3/c1-16-11(24-25-23)7-17(29-16)4-5-28-15-13(17)12(16)14(27)26(15)8-2-3-10(19)9(6-8)18(20,21)22/h2-3,6,11-13,15H,4-5,7H2,1H3/t11?,12-,13+,15+,16-,17+/m1/s1 |
| InChIKey | ORZPHHWHNOKDKY-SXSVFKLPSA-N |
| XLogP | 4.29 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|