C16H15BrF4N4O — CID 171932154
5-(5-amino-2,4-difluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine;3-bromopyridine (PubChem CID 171932154) has the molecular formula C16H15BrF4N4O and a molecular weight of 435.22 g/mol. Its IUPAC name is 5-(5-amino-2,4-difluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine;3-bromopyridine.
| Compound Name | 5-(5-amino-2,4-difluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine;3-bromopyridine |
|---|---|
| PubChem CID | 171932154 |
| Molecular Formula | C16H15BrF4N4O |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 5-(5-amino-2,4-difluorophenyl)-5-(difluoromethyl)-2,6-dihydro-1,4-oxazin-3-amine;3-bromopyridine |
| SMILES | Brc1cccnc1.NC1=NC(c2cc(N)c(F)cc2F)(C(F)F)COC1 |
| InChI | InChI=1S/C11H11F4N3O.C5H4BrN/c12-6-2-7(13)8(16)1-5(6)11(10(14)15)4-19-3-9(17)18-11;6-5-2-1-3-7-4-5/h1-2,10H,3-4,16H2,(H2,17,18);1-4H |
| InChIKey | TUIAXIZEBXHMOG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|