C14H27F3N2O2 — CID 171932272
N'-(3-cyclohexylpropyl)propane-1,3-diamine;2,2,2-trifluoroacetic acid (PubChem CID 171932272) has the molecular formula C14H27F3N2O2 and a molecular weight of 312.38 g/mol. Its IUPAC name is N'-(3-cyclohexylpropyl)propane-1,3-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | N'-(3-cyclohexylpropyl)propane-1,3-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171932272 |
| Molecular Formula | C14H27F3N2O2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N'-(3-cyclohexylpropyl)propane-1,3-diamine;2,2,2-trifluoroacetic acid |
| SMILES | NCCCNCCCC1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H26N2.C2HF3O2/c13-9-5-11-14-10-4-8-12-6-2-1-3-7-12;3-2(4,5)1(6)7/h12,14H,1-11,13H2;(H,6,7) |
| InChIKey | BFRGFERHPZHJHK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|