C25H34F6OSn — CID 171932374
tributyl-[(Z)-1,1,1,6,6,6-hexafluoro-3-(4-methoxyphenyl)hex-2-en-4-yn-2-yl]stannane (PubChem CID 171932374) has the molecular formula C25H34F6OSn and a molecular weight of 583.25 g/mol. Its IUPAC name is tributyl-[(Z)-1,1,1,6,6,6-hexafluoro-3-(4-methoxyphenyl)hex-2-en-4-yn-2-yl]stannane.
| Compound Name | tributyl-[(Z)-1,1,1,6,6,6-hexafluoro-3-(4-methoxyphenyl)hex-2-en-4-yn-2-yl]stannane |
|---|---|
| PubChem CID | 171932374 |
| Molecular Formula | C25H34F6OSn |
| Molecular Weight | 583.25 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | tributyl-[(Z)-1,1,1,6,6,6-hexafluoro-3-(4-methoxyphenyl)hex-2-en-4-yn-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C(\C#CC(F)(F)F)c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H7F6O.3C4H9.Sn/c1-20-11-4-2-9(3-5-11)10(8-13(17,18)19)6-7-12(14,15)16;3*1-3-4-2;/h2-5H,1H3;3*1,3-4H2,2H3; |
| InChIKey | KJGQGUIVBYDWEM-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.25 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|