C10H9F6NO3 — CID 171932597
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-dihydroxy-2-methoxyaniline (PubChem CID 171932597) has the molecular formula C10H9F6NO3 and a molecular weight of 305.17 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-dihydroxy-2-methoxyaniline.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-dihydroxy-2-methoxyaniline |
|---|---|
| PubChem CID | 171932597 |
| Molecular Formula | C10H9F6NO3 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-dihydroxy-2-methoxyaniline |
| SMILES | COc1ccc(C(C(F)(F)F)C(F)(F)F)cc1N(O)O |
| InChI | InChI=1S/C10H9F6NO3/c1-20-7-3-2-5(4-6(7)17(18)19)8(9(11,12)13)10(14,15)16/h2-4,8,18-19H,1H3 |
| InChIKey | VYOOSOXABIDYCW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|