C24H38F3N5O10 — CID 171932830
methyl 2-[[(3S,6S,12S,16E)-12-amino-9,9-dimethyl-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-3-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid (PubChem CID 171932830) has the molecular formula C24H38F3N5O10 and a molecular weight of 613.59 g/mol. Its IUPAC name is methyl 2-[[(3S,6S,12S,16E)-12-amino-9,9-dimethyl-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-3-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[[(3S,6S,12S,16E)-12-amino-9,9-dimethyl-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-3-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171932830 |
| Molecular Formula | C24H38F3N5O10 |
| Molecular Weight | 613.59 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | methyl 2-[[(3S,6S,12S,16E)-12-amino-9,9-dimethyl-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-3-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)CNC(=O)[C@@H]1COC/C=C/COC[C@H](N)C(=O)NC(C)(C)C(=O)NC(C(C)C)C(=O)N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H37N5O8.C2HF3O2/c1-13(2)17-20(31)25-15(19(30)24-10-16(28)33-5)12-35-9-7-6-8-34-11-14(23)18(29)27-22(3,4)21(32)26-17;3-2(4,5)1(6)7/h6-7,13-15,17H,8-12,23H2,1-5H3,(H,24,30)(H,25,31)(H,26,32)(H,27,29);(H,6,7)/b7-6+;/t14-,15-,17?;/m0./s1 |
| InChIKey | RSQDRAIPLONBPP-KIYLMEIASA-N |
| XLogP | -1.64 |
| TPSA | 224.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.59 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|