C33H48F3N5O5 — CID 171932952
tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-octyl-3-(trifluoromethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]methylidene]carbamate (PubChem CID 171932952) has the molecular formula C33H48F3N5O5 and a molecular weight of 651.77 g/mol. Its IUPAC name is tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-octyl-3-(trifluoromethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]methylidene]carbamate.
| Compound Name | tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-octyl-3-(trifluoromethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 171932952 |
| Molecular Formula | C33H48F3N5O5 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(2S)-2-[3-[4-octyl-3-(trifluoromethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]methylidene]carbamate |
| SMILES | CCCCCCCCc1ccc(C2=NOCC([C@@H]3CCCN3C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)=N2)cc1C(F)(F)F |
| InChI | InChI=1S/C33H48F3N5O5/c1-8-9-10-11-12-13-15-22-17-18-23(20-24(22)33(34,35)36)27-37-25(21-44-40-27)26-16-14-19-41(26)28(38-29(42)45-31(2,3)4)39-30(43)46-32(5,6)7/h17-18,20,26H,8-16,19,21H2,1-7H3,(H,38,39,42,43)/t26-/m0/s1 |
| InChIKey | GDEWYXHHTQTNAU-SANMLTNESA-N |
| XLogP | 8.02 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|