About disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine
disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine (PubChem CID 171934058) has the molecular formula C8H18NNa2O2P
and a molecular weight of 237.19 g/mol. Its IUPAC name is disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine.
Molecular Properties
| Compound Name | disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine |
| PubChem CID | 171934058 |
| Molecular Formula | C8H18NNa2O2P |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine |
| SMILES | CCCC(N(CC)CC)P([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H18NO2P.2Na/c1-4-7-8(12(10)11)9(5-2)6-3;;/h8H,4-7H2,1-3H3;;/q-2;2*+1 |
| InChIKey | IMHGKOJZNMYGSL-UHFFFAOYSA-N |
| XLogP | -5.51 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | -5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine?
The IUPAC name of disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine (CID 171934058) is disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine.
What is the SMILES notation for disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine?
The canonical SMILES for disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine is CCCC(N(CC)CC)P([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine?
The InChIKey is IMHGKOJZNMYGSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18NO2P.2Na/c1-4-7-8(12(10)11)9(5-2)6-3;;/h8H,4-7H2,1-3H3;;/q-2;2*+1.
What are the key properties of disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine?
disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine has a molecular weight of 237.19 g/mol, XLogP of -5.51, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;1-dioxidophosphanyl-N,N-diethylbutan-1-amine is sourced from PubChem (CID 171934058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).