About (4-bromophenyl) N-oxamoylcarbamate
(4-bromophenyl) N-oxamoylcarbamate (PubChem CID 171934087) has the molecular formula C9H7BrN2O4
and a molecular weight of 287.07 g/mol. Its IUPAC name is (4-bromophenyl) N-oxamoylcarbamate.
Molecular Properties
| Compound Name | (4-bromophenyl) N-oxamoylcarbamate |
| PubChem CID | 171934087 |
| Molecular Formula | C9H7BrN2O4 |
| Molecular Weight | 287.07 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | (4-bromophenyl) N-oxamoylcarbamate |
| SMILES | NC(=O)C(=O)NC(=O)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrN2O4/c10-5-1-3-6(4-2-5)16-9(15)12-8(14)7(11)13/h1-4H,(H2,11,13)(H,12,14,15) |
| InChIKey | WCXHLILHKIYHDL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.07 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl) N-oxamoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) N-oxamoylcarbamate?
The IUPAC name of (4-bromophenyl) N-oxamoylcarbamate (CID 171934087) is (4-bromophenyl) N-oxamoylcarbamate.
What is the SMILES notation for (4-bromophenyl) N-oxamoylcarbamate?
The canonical SMILES for (4-bromophenyl) N-oxamoylcarbamate is NC(=O)C(=O)NC(=O)Oc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl) N-oxamoylcarbamate?
The InChIKey is WCXHLILHKIYHDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O4/c10-5-1-3-6(4-2-5)16-9(15)12-8(14)7(11)13/h1-4H,(H2,11,13)(H,12,14,15).
What are the key properties of (4-bromophenyl) N-oxamoylcarbamate?
(4-bromophenyl) N-oxamoylcarbamate has a molecular weight of 287.07 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) N-oxamoylcarbamate is sourced from PubChem (CID 171934087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).