C21H19N5O5S2 — CID 17193443
2-(1,3-dioxoisoindol-2-yl)-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17193443) has the molecular formula C21H19N5O5S2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17193443 |
| Molecular Formula | C21H19N5O5S2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2nnc(NC(=O)CN3C(=O)c4ccccc4C3=O)s2)cc1 |
| InChI | InChI=1S/C21H19N5O5S2/c1-13-6-8-14(9-7-13)33(30,31)22-11-10-18-24-25-21(32-18)23-17(27)12-26-19(28)15-4-2-3-5-16(15)20(26)29/h2-9,22H,10-12H2,1H3,(H,23,25,27) |
| InChIKey | PZIBGSDOFVCAFK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|