About 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide
2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide (PubChem CID 171934730) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide.
Molecular Properties
| Compound Name | 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide |
| PubChem CID | 171934730 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide |
| SMILES | Cc1ccc(O)c(C)c1-c1cc(-c2ccncc2)cc(C(N)=O)c1N |
| InChI | InChI=1S/C20H19N3O2/c1-11-3-4-17(24)12(2)18(11)15-9-14(13-5-7-23-8-6-13)10-16(19(15)21)20(22)25/h3-10,24H,21H2,1-2H3,(H2,22,25) |
| InChIKey | WMCIJTOVEOXHKF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide?
The IUPAC name of 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide (CID 171934730) is 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide.
What is the SMILES notation for 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide?
The canonical SMILES for 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide is Cc1ccc(O)c(C)c1-c1cc(-c2ccncc2)cc(C(N)=O)c1N.
What is the InChIKey of 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide?
The InChIKey is WMCIJTOVEOXHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2/c1-11-3-4-17(24)12(2)18(11)15-9-14(13-5-7-23-8-6-13)10-16(19(15)21)20(22)25/h3-10,24H,21H2,1-2H3,(H2,22,25).
What are the key properties of 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide?
2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide has a molecular weight of 333.39 g/mol, XLogP of 3.42, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3-hydroxy-2,6-dimethylphenyl)-5-pyridin-4-ylbenzamide is sourced from PubChem (CID 171934730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).