C17H18N6O2 — CID 171934899
8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione (PubChem CID 171934899) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 171934899 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 8-[2-(1H-indol-3-yl)ethylamino]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(NCCc2c[nH]c3ccccc23)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H18N6O2/c1-22-13-14(23(2)17(25)21-15(13)24)20-16(22)18-8-7-10-9-19-12-6-4-3-5-11(10)12/h3-6,9,19H,7-8H2,1-2H3,(H,18,20)(H,21,24,25) |
| InChIKey | ZIIFDOAWIVJDPA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |