C9H14O3 — CID 171934941
(3R,4R)-4-hydroxy-3-(3-methylbut-3-enyl)oxolan-2-one (PubChem CID 171934941) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-(3-methylbut-3-enyl)oxolan-2-one.
| Compound Name | (3R,4R)-4-hydroxy-3-(3-methylbut-3-enyl)oxolan-2-one |
|---|---|
| PubChem CID | 171934941 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-(3-methylbut-3-enyl)oxolan-2-one |
| SMILES | C=C(C)CC[C@H]1C(=O)OC[C@@H]1O |
| InChI | InChI=1S/C9H14O3/c1-6(2)3-4-7-8(10)5-12-9(7)11/h7-8,10H,1,3-5H2,2H3/t7-,8+/m1/s1 |
| InChIKey | FKWSFVNTELTIIY-SFYZADRCSA-N |
| XLogP | 0.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|