C26H34N2O5 — CID 171935119
cyclohexanamine;2-[9H-fluoren-9-ylmethoxycarbonyl(2-methoxyethyl)amino]acetic acid (PubChem CID 171935119) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is cyclohexanamine;2-[9H-fluoren-9-ylmethoxycarbonyl(2-methoxyethyl)amino]acetic acid.
| Compound Name | cyclohexanamine;2-[9H-fluoren-9-ylmethoxycarbonyl(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 171935119 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | cyclohexanamine;2-[9H-fluoren-9-ylmethoxycarbonyl(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21.NC1CCCCC1 |
| InChI | InChI=1S/C20H21NO5.C6H13N/c1-25-11-10-21(12-19(22)23)20(24)26-13-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18;7-6-4-2-1-3-5-6/h2-9,18H,10-13H2,1H3,(H,22,23);6H,1-5,7H2 |
| InChIKey | QMSMHQGDASSNHQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |