2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid

C8H10O4 — CID 171935621

IUPAC2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid
SMILESC=C(C)C(=O)C=C(OC)C(=O)O
InChIInChI=1S/C8H10O4/c1-5(2)6(9)4-7(12-3)8(10)11/h4H,1H2,2-3H3,(H,10,11)
InChIKeyGOGVZAPHZPKSCH-UHFFFAOYSA-N
MW170.16 g/mol
LogP0.75
Rot. Bonds4

About 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid

2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid (PubChem CID 171935621) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid.

Molecular Properties

Compound Name2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid
PubChem CID171935621
Molecular FormulaC8H10O4
Molecular Weight170.16 g/mol
Exact Mass170.06
IUPAC Name2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid
SMILESC=C(C)C(=O)C=C(OC)C(=O)O
InChIInChI=1S/C8H10O4/c1-5(2)6(9)4-7(12-3)8(10)11/h4H,1H2,2-3H3,(H,10,11)
InChIKeyGOGVZAPHZPKSCH-UHFFFAOYSA-N
XLogP0.75
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.16
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid?
The IUPAC name of 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid (CID 171935621) is 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid.
What is the SMILES notation for 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid?
The canonical SMILES for 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid is C=C(C)C(=O)C=C(OC)C(=O)O.
What is the InChIKey of 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid?
The InChIKey is GOGVZAPHZPKSCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-5(2)6(9)4-7(12-3)8(10)11/h4H,1H2,2-3H3,(H,10,11).
What are the key properties of 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid?
2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid has a molecular weight of 170.16 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-methyl-4-oxohexa-2,5-dienoic acid is sourced from PubChem (CID 171935621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).