About furan-3-ylmethyl hexanoate
furan-3-ylmethyl hexanoate (PubChem CID 171935630) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is furan-3-ylmethyl hexanoate.
Molecular Properties
| Compound Name | furan-3-ylmethyl hexanoate |
| PubChem CID | 171935630 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | furan-3-ylmethyl hexanoate |
| SMILES | CCCCCC(=O)OCc1ccoc1 |
| InChI | InChI=1S/C11H16O3/c1-2-3-4-5-11(12)14-9-10-6-7-13-8-10/h6-8H,2-5,9H2,1H3 |
| InChIKey | OPLXMFKNLLLHCO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze furan-3-ylmethyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-ylmethyl hexanoate?
The IUPAC name of furan-3-ylmethyl hexanoate (CID 171935630) is furan-3-ylmethyl hexanoate.
What is the SMILES notation for furan-3-ylmethyl hexanoate?
The canonical SMILES for furan-3-ylmethyl hexanoate is CCCCCC(=O)OCc1ccoc1.
What is the InChIKey of furan-3-ylmethyl hexanoate?
The InChIKey is OPLXMFKNLLLHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-2-3-4-5-11(12)14-9-10-6-7-13-8-10/h6-8H,2-5,9H2,1H3.
What are the key properties of furan-3-ylmethyl hexanoate?
furan-3-ylmethyl hexanoate has a molecular weight of 196.25 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-ylmethyl hexanoate is sourced from PubChem (CID 171935630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).