C32H33N5O2 — CID 171935723
methyl 1-[4-[2-[(5-methyl-6H-indolo[2,3-b]quinolin-11-ylidene)amino]ethylamino]butyl]indole-3-carboxylate (PubChem CID 171935723) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is methyl 1-[4-[2-[(5-methyl-6H-indolo[2,3-b]quinolin-11-ylidene)amino]ethylamino]butyl]indole-3-carboxylate.
| Compound Name | methyl 1-[4-[2-[(5-methyl-6H-indolo[2,3-b]quinolin-11-ylidene)amino]ethylamino]butyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 171935723 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | methyl 1-[4-[2-[(5-methyl-6H-indolo[2,3-b]quinolin-11-ylidene)amino]ethylamino]butyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CCCCNCC/N=c2\c3ccccc3n(C)c3[nH]c4ccccc4c23)c2ccccc12 |
| InChI | InChI=1S/C32H33N5O2/c1-36-27-15-7-5-13-24(27)30(29-23-12-3-6-14-26(23)35-31(29)36)34-19-18-33-17-9-10-20-37-21-25(32(38)39-2)22-11-4-8-16-28(22)37/h3-8,11-16,21,33,35H,9-10,17-20H2,1-2H3/b34-30+ |
| InChIKey | PHEOJPBCRFRGBO-VBMGMRCRSA-N |
| XLogP | 5.52 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|