C13H21NO4S — CID 171936567
3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-thiabicyclo[3.2.1]octane-3-carboxylic acid (PubChem CID 171936567) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-thiabicyclo[3.2.1]octane-3-carboxylic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-thiabicyclo[3.2.1]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 171936567 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-thiabicyclo[3.2.1]octane-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)O)CC2CCC(C1)S2 |
| InChI | InChI=1S/C13H21NO4S/c1-12(2,3)18-11(17)14-13(10(15)16)6-8-4-5-9(7-13)19-8/h8-9H,4-7H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | INOHWXVLVNYYKO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |