About 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol
4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol (PubChem CID 171936924) has the molecular formula C8H12F2O2S
and a molecular weight of 210.24 g/mol. Its IUPAC name is 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol.
Molecular Properties
| Compound Name | 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol |
| PubChem CID | 171936924 |
| Molecular Formula | C8H12F2O2S |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol |
| SMILES | O=S1C2CCC1CC(F)(F)C(O)C2 |
| InChI | InChI=1S/C8H12F2O2S/c9-8(10)4-6-2-1-5(13(6)12)3-7(8)11/h5-7,11H,1-4H2 |
| InChIKey | KQGUHOLSKWWEKY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol?
The IUPAC name of 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol (CID 171936924) is 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol.
What is the SMILES notation for 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol?
The canonical SMILES for 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol is O=S1C2CCC1CC(F)(F)C(O)C2.
What is the InChIKey of 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol?
The InChIKey is KQGUHOLSKWWEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O2S/c9-8(10)4-6-2-1-5(13(6)12)3-7(8)11/h5-7,11H,1-4H2.
What are the key properties of 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol?
4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol has a molecular weight of 210.24 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-9-oxo-9λ4-thiabicyclo[4.2.1]nonan-3-ol is sourced from PubChem (CID 171936924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).