About 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol
4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol (PubChem CID 171936934) has the molecular formula C9H14F2O3S
and a molecular weight of 240.27 g/mol. Its IUPAC name is 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol.
Molecular Properties
| Compound Name | 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol |
| PubChem CID | 171936934 |
| Molecular Formula | C9H14F2O3S |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol |
| SMILES | O=S1(=O)C2CCCC1CC(F)(F)C(O)C2 |
| InChI | InChI=1S/C9H14F2O3S/c10-9(11)5-7-3-1-2-6(4-8(9)12)15(7,13)14/h6-8,12H,1-5H2 |
| InChIKey | ADEFPDIGRQTCRR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol?
The IUPAC name of 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol (CID 171936934) is 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol.
What is the SMILES notation for 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol?
The canonical SMILES for 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol is O=S1(=O)C2CCCC1CC(F)(F)C(O)C2.
What is the InChIKey of 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol?
The InChIKey is ADEFPDIGRQTCRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O3S/c10-9(11)5-7-3-1-2-6(4-8(9)12)15(7,13)14/h6-8,12H,1-5H2.
What are the key properties of 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol?
4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol has a molecular weight of 240.27 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-10,10-dioxo-10λ6-thiabicyclo[4.3.1]decan-3-ol is sourced from PubChem (CID 171936934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).