benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate

C16H20BrNO2 — CID 171937053

IUPACbenzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate
SMILESO=C(OCc1ccccc1)N1C2CCC1CC(CBr)C2
InChIInChI=1S/C16H20BrNO2/c17-10-13-8-14-6-7-15(9-13)18(14)16(19)20-11-12-4-2-1-3-5-12/h1-5,13-15H,6-11H2
InChIKeyDWSPJESIDHCETC-UHFFFAOYSA-N
MW338.25 g/mol
LogP3.96
Rot. Bonds3

About benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate

benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171937053) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.

Molecular Properties

Compound Namebenzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate
PubChem CID171937053
Molecular FormulaC16H20BrNO2
Molecular Weight338.25 g/mol
Exact Mass337.07
IUPAC Namebenzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate
SMILESO=C(OCc1ccccc1)N1C2CCC1CC(CBr)C2
InChIInChI=1S/C16H20BrNO2/c17-10-13-8-14-6-7-15(9-13)18(14)16(19)20-11-12-4-2-1-3-5-12/h1-5,13-15H,6-11H2
InChIKeyDWSPJESIDHCETC-UHFFFAOYSA-N
XLogP3.96
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.25
LogP ≤ 53.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 171937053) is benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate is O=C(OCc1ccccc1)N1C2CCC1CC(CBr)C2.
What is the InChIKey of benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is DWSPJESIDHCETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrNO2/c17-10-13-8-14-6-7-15(9-13)18(14)16(19)20-11-12-4-2-1-3-5-12/h1-5,13-15H,6-11H2.
What are the key properties of benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate?
benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 338.25 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(bromomethyl)-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 171937053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).