About 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol
2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol (PubChem CID 171937165) has the molecular formula C9H16O2S
and a molecular weight of 188.29 g/mol. Its IUPAC name is 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol |
| PubChem CID | 171937165 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol |
| SMILES | O=S1C2CCC1CC(CCO)C2 |
| InChI | InChI=1S/C9H16O2S/c10-4-3-7-5-8-1-2-9(6-7)12(8)11/h7-10H,1-6H2 |
| InChIKey | NUHAQBPCCGPVFF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol?
The IUPAC name of 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol (CID 171937165) is 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol.
What is the SMILES notation for 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol?
The canonical SMILES for 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol is O=S1C2CCC1CC(CCO)C2.
What is the InChIKey of 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol?
The InChIKey is NUHAQBPCCGPVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2S/c10-4-3-7-5-8-1-2-9(6-7)12(8)11/h7-10H,1-6H2.
What are the key properties of 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol?
2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol has a molecular weight of 188.29 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)ethanol is sourced from PubChem (CID 171937165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).