C19H25NO5 — CID 171937213
benzyl 7-(2-ethoxy-2-oxoethyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171937213) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is benzyl 7-(2-ethoxy-2-oxoethyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 7-(2-ethoxy-2-oxoethyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171937213 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | benzyl 7-(2-ethoxy-2-oxoethyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CCOC(=O)CC1CC2COCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO5/c1-2-24-18(21)10-15-8-16-12-23-13-17(9-15)20(16)19(22)25-11-14-6-4-3-5-7-14/h3-7,15-17H,2,8-13H2,1H3 |
| InChIKey | DYYUVHNCDSBAMR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |