About cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone
cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171937713) has the molecular formula C15H24O2S
and a molecular weight of 268.42 g/mol. Its IUPAC name is cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| PubChem CID | 171937713 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(C1CCCCC1)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C15H24O2S/c16-15(11-5-2-1-3-6-11)12-9-13-7-4-8-14(10-12)18(13)17/h11-14H,1-10H2 |
| InChIKey | GUGFBOPZNAUDPI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The IUPAC name of cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (CID 171937713) is cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
What is the SMILES notation for cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The canonical SMILES for cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone is O=C(C1CCCCC1)C1CC2CCCC(C1)S2=O.
What is the InChIKey of cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The InChIKey is GUGFBOPZNAUDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2S/c16-15(11-5-2-1-3-6-11)12-9-13-7-4-8-14(10-12)18(13)17/h11-14H,1-10H2.
What are the key properties of cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone has a molecular weight of 268.42 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone is sourced from PubChem (CID 171937713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).