About 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile
6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile (PubChem CID 171937800) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile.
Molecular Properties
| Compound Name | 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile |
| PubChem CID | 171937800 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile |
| SMILES | N#CCCCCC(=O)C1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C13H19NO2S/c14-7-3-1-2-4-13(15)10-8-11-5-6-12(9-10)17(11)16/h10-12H,1-6,8-9H2 |
| InChIKey | MQPYDOQGZZNZSK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile?
The IUPAC name of 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile (CID 171937800) is 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile.
What is the SMILES notation for 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile?
The canonical SMILES for 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile is N#CCCCCC(=O)C1CC2CCC(C1)S2=O.
What is the InChIKey of 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile?
The InChIKey is MQPYDOQGZZNZSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c14-7-3-1-2-4-13(15)10-8-11-5-6-12(9-10)17(11)16/h10-12H,1-6,8-9H2.
What are the key properties of 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile?
6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile has a molecular weight of 253.37 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-6-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hexanenitrile is sourced from PubChem (CID 171937800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).