About 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one
1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one (PubChem CID 171937875) has the molecular formula C14H22O2S
and a molecular weight of 254.39 g/mol. Its IUPAC name is 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one.
Molecular Properties
| Compound Name | 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one |
| PubChem CID | 171937875 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one |
| SMILES | C=CCCCCC(=O)C1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C14H22O2S/c1-2-3-4-5-6-14(15)11-9-12-7-8-13(10-11)17(12)16/h2,11-13H,1,3-10H2 |
| InChIKey | IWQJBEIAZZCBJD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
The IUPAC name of 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one (CID 171937875) is 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one.
What is the SMILES notation for 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
The canonical SMILES for 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one is C=CCCCCC(=O)C1CC2CCC(C1)S2=O.
What is the InChIKey of 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
The InChIKey is IWQJBEIAZZCBJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2S/c1-2-3-4-5-6-14(15)11-9-12-7-8-13(10-11)17(12)16/h2,11-13H,1,3-10H2.
What are the key properties of 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one has a molecular weight of 254.39 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one is sourced from PubChem (CID 171937875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).