About 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one (PubChem CID 171937876) has the molecular formula C14H22O3S
and a molecular weight of 270.39 g/mol. Its IUPAC name is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one.
Molecular Properties
| Compound Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one |
| PubChem CID | 171937876 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one |
| SMILES | C=CCCCCC(=O)C1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C14H22O3S/c1-2-3-4-5-6-14(15)11-9-12-7-8-13(10-11)18(12,16)17/h2,11-13H,1,3-10H2 |
| InChIKey | NYANAICJYXTMOX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
The IUPAC name of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one (CID 171937876) is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one.
What is the SMILES notation for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
The canonical SMILES for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one is C=CCCCCC(=O)C1CC2CCC(C1)S2(=O)=O.
What is the InChIKey of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
The InChIKey is NYANAICJYXTMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3S/c1-2-3-4-5-6-14(15)11-9-12-7-8-13(10-11)18(12,16)17/h2,11-13H,1,3-10H2.
What are the key properties of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one?
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one has a molecular weight of 270.39 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)hept-6-en-1-one is sourced from PubChem (CID 171937876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).