About 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one
1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one (PubChem CID 171937934) has the molecular formula C15H24O3S
and a molecular weight of 284.42 g/mol. Its IUPAC name is 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one.
Molecular Properties
| Compound Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one |
| PubChem CID | 171937934 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one |
| SMILES | CC(C)=CCCC(=O)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C15H24O3S/c1-11(2)5-3-8-15(16)12-9-13-6-4-7-14(10-12)19(13,17)18/h5,12-14H,3-4,6-10H2,1-2H3 |
| InChIKey | ZUIWQXZGTMGZAC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one?
The IUPAC name of 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one (CID 171937934) is 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one.
What is the SMILES notation for 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one?
The canonical SMILES for 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one is CC(C)=CCCC(=O)C1CC2CCCC(C1)S2(=O)=O.
What is the InChIKey of 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one?
The InChIKey is ZUIWQXZGTMGZAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3S/c1-11(2)5-3-8-15(16)12-9-13-6-4-7-14(10-12)19(13,17)18/h5,12-14H,3-4,6-10H2,1-2H3.
What are the key properties of 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one?
1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one has a molecular weight of 284.42 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-5-methylhex-4-en-1-one is sourced from PubChem (CID 171937934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).