About 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one (PubChem CID 171938047) has the molecular formula C13H22O3SSi
and a molecular weight of 286.47 g/mol. Its IUPAC name is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one |
| PubChem CID | 171938047 |
| Molecular Formula | C13H22O3SSi |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one |
| SMILES | C=C(C(=O)C1CC2CCC(C1)S2(=O)=O)[Si](C)(C)C |
| InChI | InChI=1S/C13H22O3SSi/c1-9(18(2,3)4)13(14)10-7-11-5-6-12(8-10)17(11,15)16/h10-12H,1,5-8H2,2-4H3 |
| InChIKey | CSNIQGNFRIJHKQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one?
The IUPAC name of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one (CID 171938047) is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one.
What is the SMILES notation for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one?
The canonical SMILES for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one is C=C(C(=O)C1CC2CCC(C1)S2(=O)=O)[Si](C)(C)C.
What is the InChIKey of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one?
The InChIKey is CSNIQGNFRIJHKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3SSi/c1-9(18(2,3)4)13(14)10-7-11-5-6-12(8-10)17(11,15)16/h10-12H,1,5-8H2,2-4H3.
What are the key properties of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one?
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one has a molecular weight of 286.47 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-2-trimethylsilylprop-2-en-1-one is sourced from PubChem (CID 171938047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).