C13H23NO2Si — CID 171938057
1-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-trimethylsilylprop-2-en-1-one (PubChem CID 171938057) has the molecular formula C13H23NO2Si and a molecular weight of 253.42 g/mol. Its IUPAC name is 1-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-trimethylsilylprop-2-en-1-one.
| Compound Name | 1-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-trimethylsilylprop-2-en-1-one |
|---|---|
| PubChem CID | 171938057 |
| Molecular Formula | C13H23NO2Si |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-trimethylsilylprop-2-en-1-one |
| SMILES | C=C(C(=O)C1CC2COCC(C1)N2)[Si](C)(C)C |
| InChI | InChI=1S/C13H23NO2Si/c1-9(17(2,3)4)13(15)10-5-11-7-16-8-12(6-10)14-11/h10-12,14H,1,5-8H2,2-4H3 |
| InChIKey | MIIWWTOCLXKCSE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|