About 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one (PubChem CID 171938241) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one.
Molecular Properties
| Compound Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one |
| PubChem CID | 171938241 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one |
| SMILES | C=C(C)CC(=O)C1CC2CCC(C1)S2(=O)=O |
| InChI | InChI=1S/C12H18O3S/c1-8(2)5-12(13)9-6-10-3-4-11(7-9)16(10,14)15/h9-11H,1,3-7H2,2H3 |
| InChIKey | FEDHQDGOZSCRPL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one?
The IUPAC name of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one (CID 171938241) is 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one.
What is the SMILES notation for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one?
The canonical SMILES for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one is C=C(C)CC(=O)C1CC2CCC(C1)S2(=O)=O.
What is the InChIKey of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one?
The InChIKey is FEDHQDGOZSCRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-8(2)5-12(13)9-6-10-3-4-11(7-9)16(10,14)15/h9-11H,1,3-7H2,2H3.
What are the key properties of 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one?
1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one has a molecular weight of 242.34 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-yl)-3-methylbut-3-en-1-one is sourced from PubChem (CID 171938241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).