C29H33NO3 — CID 171938633
9H-fluoren-9-ylmethyl 3-(4-methylpent-3-enoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171938633) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-(4-methylpent-3-enoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-(4-methylpent-3-enoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171938633 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-(4-methylpent-3-enoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)=CCC(=O)C1CC2CCCC(C1)N2C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H33NO3/c1-19(2)14-15-28(31)20-16-21-8-7-9-22(17-20)30(21)29(32)33-18-27-25-12-5-3-10-23(25)24-11-4-6-13-26(24)27/h3-6,10-14,20-22,27H,7-9,15-18H2,1-2H3 |
| InChIKey | QZJLOWDPWQKGFZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|