About 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one
1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one (PubChem CID 171938678) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one.
Molecular Properties
| Compound Name | 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one |
| PubChem CID | 171938678 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one |
| SMILES | CC(C)=C(C)C(=O)C1CC2CCCC(C1)N2 |
| InChI | InChI=1S/C14H23NO/c1-9(2)10(3)14(16)11-7-12-5-4-6-13(8-11)15-12/h11-13,15H,4-8H2,1-3H3 |
| InChIKey | PVVYXCYOLIHNPV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one?
The IUPAC name of 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one (CID 171938678) is 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one.
What is the SMILES notation for 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one?
The canonical SMILES for 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one is CC(C)=C(C)C(=O)C1CC2CCCC(C1)N2.
What is the InChIKey of 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one?
The InChIKey is PVVYXCYOLIHNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-9(2)10(3)14(16)11-7-12-5-4-6-13(8-11)15-12/h11-13,15H,4-8H2,1-3H3.
What are the key properties of 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one?
1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one has a molecular weight of 221.34 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-azabicyclo[3.3.1]nonan-3-yl)-2,3-dimethylbut-2-en-1-one is sourced from PubChem (CID 171938678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).