C18H30FNO3 — CID 171938706
tert-butyl 3-(5-fluoropentanoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171938706) has the molecular formula C18H30FNO3 and a molecular weight of 327.44 g/mol. Its IUPAC name is tert-butyl 3-(5-fluoropentanoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-(5-fluoropentanoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171938706 |
| Molecular Formula | C18H30FNO3 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl 3-(5-fluoropentanoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1CC(C(=O)CCCCF)C2 |
| InChI | InChI=1S/C18H30FNO3/c1-18(2,3)23-17(22)20-14-7-6-8-15(20)12-13(11-14)16(21)9-4-5-10-19/h13-15H,4-12H2,1-3H3 |
| InChIKey | BTEMWFKWWIPUAJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|