About 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one
5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one (PubChem CID 171938710) has the molecular formula C13H21FO2S
and a molecular weight of 260.37 g/mol. Its IUPAC name is 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one.
Molecular Properties
| Compound Name | 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one |
| PubChem CID | 171938710 |
| Molecular Formula | C13H21FO2S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one |
| SMILES | O=C(CCCCF)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C13H21FO2S/c14-7-2-1-6-13(15)10-8-11-4-3-5-12(9-10)17(11)16/h10-12H,1-9H2 |
| InChIKey | MJQLHBCTGXJABF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one?
The IUPAC name of 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one (CID 171938710) is 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one.
What is the SMILES notation for 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one?
The canonical SMILES for 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one is O=C(CCCCF)C1CC2CCCC(C1)S2=O.
What is the InChIKey of 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one?
The InChIKey is MJQLHBCTGXJABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21FO2S/c14-7-2-1-6-13(15)10-8-11-4-3-5-12(9-10)17(11)16/h10-12H,1-9H2.
What are the key properties of 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one?
5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one has a molecular weight of 260.37 g/mol, XLogP of 2.78, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pentan-1-one is sourced from PubChem (CID 171938710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).