C19H22N2O2 — CID 171938730
(9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-(1,2-oxazol-4-yl)methanone (PubChem CID 171938730) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-(1,2-oxazol-4-yl)methanone.
| Compound Name | (9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-(1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 171938730 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-(1,2-oxazol-4-yl)methanone |
| SMILES | O=C(c1cnoc1)C1CC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c22-19(16-11-20-23-13-16)15-9-17-7-4-8-18(10-15)21(17)12-14-5-2-1-3-6-14/h1-3,5-6,11,13,15,17-18H,4,7-10,12H2 |
| InChIKey | FYKUCMMCQOSTKQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |