About cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone
cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171939007) has the molecular formula C11H16O2S
and a molecular weight of 212.31 g/mol. Its IUPAC name is cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
| PubChem CID | 171939007 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | O=C(C1CC1)C1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C11H16O2S/c12-11(7-1-2-7)8-5-9-3-4-10(6-8)14(9)13/h7-10H,1-6H2 |
| InChIKey | SRRUTAYPTFFWDG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone?
The IUPAC name of cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone (CID 171939007) is cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone.
What is the SMILES notation for cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone?
The canonical SMILES for cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone is O=C(C1CC1)C1CC2CCC(C1)S2=O.
What is the InChIKey of cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone?
The InChIKey is SRRUTAYPTFFWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2S/c12-11(7-1-2-7)8-5-9-3-4-10(6-8)14(9)13/h7-10H,1-6H2.
What are the key properties of cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone?
cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone has a molecular weight of 212.31 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone is sourced from PubChem (CID 171939007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).