C29H28N2O2 — CID 171939420
2-[4-[2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-oxoethyl]phenyl]benzonitrile (PubChem CID 171939420) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[4-[2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-oxoethyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-oxoethyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 171939420 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-[4-[2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-2-oxoethyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(CC(=O)C2CC3COCC(C2)N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H28N2O2/c30-17-24-8-4-5-9-28(24)23-12-10-21(11-13-23)14-29(32)25-15-26-19-33-20-27(16-25)31(26)18-22-6-2-1-3-7-22/h1-13,25-27H,14-16,18-20H2 |
| InChIKey | XSYXKQVERXNAJB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |