C33H37NO3Si — CID 171941324
9H-fluoren-9-ylmethyl 3-(4-trimethylsilylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171941324) has the molecular formula C33H37NO3Si and a molecular weight of 523.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-(4-trimethylsilylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-(4-trimethylsilylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171941324 |
| Molecular Formula | C33H37NO3Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-(4-trimethylsilylbenzoyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | C[Si](C)(C)c1ccc(C(=O)C2CC3CCCC(C2)N3C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C33H37NO3Si/c1-38(2,3)26-17-15-22(16-18-26)32(35)23-19-24-9-8-10-25(20-23)34(24)33(36)37-21-31-29-13-6-4-11-27(29)28-12-5-7-14-30(28)31/h4-7,11-18,23-25,31H,8-10,19-21H2,1-3H3 |
| InChIKey | RKAXZNOMHJCFSM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|