C22H33NO4Si — CID 171941333
tert-butyl 7-(4-trimethylsilylbenzoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171941333) has the molecular formula C22H33NO4Si and a molecular weight of 403.60 g/mol. Its IUPAC name is tert-butyl 7-(4-trimethylsilylbenzoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 7-(4-trimethylsilylbenzoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171941333 |
| Molecular Formula | C22H33NO4Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | tert-butyl 7-(4-trimethylsilylbenzoyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2COCC1CC(C(=O)c1ccc([Si](C)(C)C)cc1)C2 |
| InChI | InChI=1S/C22H33NO4Si/c1-22(2,3)27-21(25)23-17-11-16(12-18(23)14-26-13-17)20(24)15-7-9-19(10-8-15)28(4,5)6/h7-10,16-18H,11-14H2,1-6H3 |
| InChIKey | JSJIUYYFXLEXCW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|