C23H22F3NO4 — CID 171941508
benzyl 7-[3-(trifluoromethyl)benzoyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171941508) has the molecular formula C23H22F3NO4 and a molecular weight of 433.43 g/mol. Its IUPAC name is benzyl 7-[3-(trifluoromethyl)benzoyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 7-[3-(trifluoromethyl)benzoyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171941508 |
| Molecular Formula | C23H22F3NO4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | benzyl 7-[3-(trifluoromethyl)benzoyl]-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)C1CC2COCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H22F3NO4/c24-23(25,26)18-8-4-7-16(9-18)21(28)17-10-19-13-30-14-20(11-17)27(19)22(29)31-12-15-5-2-1-3-6-15/h1-9,17,19-20H,10-14H2 |
| InChIKey | SERITSSKBGNYLF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |