C30H37NO6 — CID 171941610
9H-fluoren-9-ylmethyl 3-[3-[2-(2-methoxyethoxy)ethoxy]propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171941610) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-[3-[2-(2-methoxyethoxy)ethoxy]propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-[3-[2-(2-methoxyethoxy)ethoxy]propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171941610 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-[3-[2-(2-methoxyethoxy)ethoxy]propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCCOCCOCCC(=O)C1CC2CCC(C1)N2C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H37NO6/c1-34-14-15-36-17-16-35-13-12-29(32)21-18-22-10-11-23(19-21)31(22)30(33)37-20-28-26-8-4-2-6-24(26)25-7-3-5-9-27(25)28/h2-9,21-23,28H,10-20H2,1H3 |
| InChIKey | UETUKPYGJZIMPT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|