C22H20ClNO2 — CID 17194172
N-[(2-chlorophenyl)methyl]-2-(4-phenylphenoxy)propanamide (PubChem CID 17194172) has the molecular formula C22H20ClNO2 and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(4-phenylphenoxy)propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(4-phenylphenoxy)propanamide |
|---|---|
| PubChem CID | 17194172 |
| Molecular Formula | C22H20ClNO2 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(4-phenylphenoxy)propanamide |
| SMILES | CC(Oc1ccc(-c2ccccc2)cc1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C22H20ClNO2/c1-16(22(25)24-15-19-9-5-6-10-21(19)23)26-20-13-11-18(12-14-20)17-7-3-2-4-8-17/h2-14,16H,15H2,1H3,(H,24,25) |
| InChIKey | DSJROMMHUMYXLP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |