C18H19NO3S — CID 171941871
(9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-quinolin-7-ylmethanone (PubChem CID 171941871) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-quinolin-7-ylmethanone.
| Compound Name | (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-quinolin-7-ylmethanone |
|---|---|
| PubChem CID | 171941871 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-yl)-quinolin-7-ylmethanone |
| SMILES | O=C(c1ccc2cccnc2c1)C1CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C18H19NO3S/c20-18(13-7-6-12-3-2-8-19-17(12)11-13)14-9-15-4-1-5-16(10-14)23(15,21)22/h2-3,6-8,11,14-16H,1,4-5,9-10H2 |
| InChIKey | YONGSCJJIYPIED-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |