C14H17NO2S — CID 171943402
(2-methoxy-4-pyridinyl)-(8-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171943402) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (2-methoxy-4-pyridinyl)-(8-thiabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | (2-methoxy-4-pyridinyl)-(8-thiabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 171943402 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (2-methoxy-4-pyridinyl)-(8-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | COc1cc(C(=O)C2CC3CCC(C2)S3)ccn1 |
| InChI | InChI=1S/C14H17NO2S/c1-17-13-8-9(4-5-15-13)14(16)10-6-11-2-3-12(7-10)18-11/h4-5,8,10-12H,2-3,6-7H2,1H3 |
| InChIKey | UKHQISMRSSDYMM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |