C19H26N2O4 — CID 171943496
tert-butyl 3-(3-methoxypyridine-2-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171943496) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl 3-(3-methoxypyridine-2-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-(3-methoxypyridine-2-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171943496 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl 3-(3-methoxypyridine-2-carbonyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COc1cccnc1C(=O)C1CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,3)25-18(23)21-13-7-8-14(21)11-12(10-13)17(22)16-15(24-4)6-5-9-20-16/h5-6,9,12-14H,7-8,10-11H2,1-4H3 |
| InChIKey | YHIZTOMXSDOZFX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |