About imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone
imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171945552) has the molecular formula C15H17N3O2S
and a molecular weight of 303.39 g/mol. Its IUPAC name is imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| PubChem CID | 171945552 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(c1cnc2cnccn12)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C15H17N3O2S/c19-15(13-8-17-14-9-16-4-5-18(13)14)10-6-11-2-1-3-12(7-10)21(11)20/h4-5,8-12H,1-3,6-7H2 |
| InChIKey | PXPPFNLBTZASLV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The IUPAC name of imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (CID 171945552) is imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
What is the SMILES notation for imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The canonical SMILES for imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone is O=C(c1cnc2cnccn12)C1CC2CCCC(C1)S2=O.
What is the InChIKey of imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
The InChIKey is PXPPFNLBTZASLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2S/c19-15(13-8-17-14-9-16-4-5-18(13)14)10-6-11-2-1-3-12(7-10)21(11)20/h4-5,8-12H,1-3,6-7H2.
What are the key properties of imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone?
imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone has a molecular weight of 303.39 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyrazin-3-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone is sourced from PubChem (CID 171945552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).